Ald-Ph-PEG2-NH-Boc
Modify Date: 2025-08-26 20:56:05
Ald-Ph-PEG2-NH-Boc structure
|
Common Name | Ald-Ph-PEG2-NH-Boc | ||
|---|---|---|---|---|
| CAS Number | 1807503-90-7 | Molecular Weight | 380.435 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 581.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H28N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.4±30.1 °C | |
Use of Ald-Ph-PEG2-NH-BocAld-Ph-PEG2-NH-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Ald-Ph-PEG2-NHBoc |
|---|---|
| Synonym | More Synonyms |
| Description | Ald-Ph-PEG2-NH-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 581.3±50.0 °C at 760 mmHg |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.435 |
| Flash Point | 305.4±30.1 °C |
| Exact Mass | 380.194733 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | MSCITXKKGMUNOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)c1ccc(C=O)cc1 |
| ALD-PH-PEG2-NH-BOC |