m-PEG-acid structure
|
Common Name | m-PEG-acid | ||
|---|---|---|---|---|
| CAS Number | 125220-94-2 | Molecular Weight | 588.683 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 628.8±55.0 °C at 760 mmHg | |
| Molecular Formula | (C2H4O)nC4H8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.3±25.0 °C | |
Use of m-PEG-acidm-PEG-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaoctatriacontan-38-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 628.8±55.0 °C at 760 mmHg |
| Molecular Formula | (C2H4O)nC4H8O3 |
| Molecular Weight | 588.683 |
| Flash Point | 189.3±25.0 °C |
| Exact Mass | 588.335693 |
| LogP | -4.22 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | JMAKFNFKUHXFBH-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| MFCD08274611 |
| 2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaoctatriacontan-38-oic acid |