PKSI-527 structure
|
Common Name | PKSI-527 | ||
|---|---|---|---|---|
| CAS Number | 128837-71-8 | Molecular Weight | 473.99 | |
| Density | N/A | Boiling Point | 763.1ºC at 760mmHg | |
| Molecular Formula | C25H32ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 415.3ºC | |
Use of PKSI-527PKSI-527 is a new, highly selective plasma kallikrein inhibitor. PKSI-527 can suppress collagen-induced arthritis (CIA) by modifying the kallikrein-kinin system[1]. |
| Name | 2-[4-[[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-phenylpropanoyl]amino]phenyl]acetic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | PKSI-527 is a new, highly selective plasma kallikrein inhibitor. PKSI-527 can suppress collagen-induced arthritis (CIA) by modifying the kallikrein-kinin system[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 763.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C25H32ClN3O4 |
| Molecular Weight | 473.99 |
| Flash Point | 415.3ºC |
| Exact Mass | 473.20800 |
| PSA | 125.01000 |
| LogP | 5.16040 |
| Vapour Pressure | 1.74E-24mmHg at 25°C |
| InChIKey | NAXNMKUKSBHHMP-QCXPCDNBSA-N |
| SMILES | Cl.NCC1CCC(C(=O)NC(Cc2ccccc2)C(=O)Nc2ccc(CC(=O)O)cc2)CC1 |
| H-Tra-L-Phe-4-carboxymethylanilide hydrochloride |
| Pksi 527 |
| PKSI-0527 |
| C25H31N3O4.HCl |
| t-AMCHA-Phe-p-APAA |