m-PEG5-Ms structure
|
Common Name | m-PEG5-Ms | ||
|---|---|---|---|---|
| CAS Number | 130955-38-3 | Molecular Weight | 330.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H26O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG5-Msm-PEG5-Ms is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | m-PEG5-Ms |
|---|
| Description | m-PEG5-Ms is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
[1]. Sanxing Sun, et al. Triazolotriazine derivatives as a2a receptor antagonists. WO2020002969A1. |
| Molecular Formula | C12H26O8S |
|---|---|
| Molecular Weight | 330.40 |
| InChIKey | GIZXGFFADYUCPD-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOS(C)(=O)=O |
| Hazard Codes | Xi |
|---|