m-PEG5-Tos structure
|
Common Name | m-PEG5-Tos | ||
|---|---|---|---|---|
| CAS Number | 80755-67-5 | Molecular Weight | 424.50600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG5-Tosm-PEG5-Tos is a derivative of silybin ethers, extracted from patent CN105037337A (compound III-c). m-PEG5-Tos is a PEG-based PROTAC linker can be used in the synthesis of Silymarin (HY-W043277)[1]. |
| Name | 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG5-Tos is a derivative of silybin ethers, extracted from patent CN105037337A (compound III-c). m-PEG5-Tos is a PEG-based PROTAC linker can be used in the synthesis of Silymarin (HY-W043277)[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C18H30O8S |
|---|---|
| Molecular Weight | 424.50600 |
| Exact Mass | 424.17700 |
| PSA | 129.13000 |
| LogP | 2.01400 |
| InChIKey | ARGVXLRPEZMWEQ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| Storage condition | 2-8°C |
| 2,5,8,11,14-Pentaoxahexadecan-16-ol,4-methylbenzenesulfonate |
| pentaethylene glycol mono methyl ether tosylate |
| pentaethyleneglycol monomethyl ether monotosylate |
| pentaethyleneglycol momomethyl ether tosylate |
| 14-methoxy-3,6,9,12-tetraoxatetradecyl toluene-p-sulfonate |
| TsO(CH2CH2O)5Me |