mc 77 structure
|
Common Name | mc 77 | ||
|---|---|---|---|---|
| CAS Number | 134136-38-2 | Molecular Weight | 756.71000 | |
| Density | 1.49g/cm3 | Boiling Point | 849.7ºC at 760mmHg | |
| Molecular Formula | C35H40N4O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 467.7ºC | |
| Name | mc 77 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 849.7ºC at 760mmHg |
| Molecular Formula | C35H40N4O15 |
| Molecular Weight | 756.71000 |
| Flash Point | 467.7ºC |
| Exact Mass | 756.24900 |
| PSA | 257.55000 |
| LogP | 0.81760 |
| Vapour Pressure | 3.73E-29mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | OONKIOWWPLCSQD-NPHOOMDASA-N |
| SMILES | COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(Nc4ccc(OC5OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C5OC(C)=O)cc4)C3=O)N1CC1NC12 |
|
~69%
mc 77 CAS#:134136-38-2 |
| Literature: Furuhata; Komiyama; Ogura; Hata Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 2 p. 255 - 259 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MC-77 |
| N-(4-(2,3,4,6-Tetra-O-acetyl-D-glucopyranosyl)oxy)phenylmitomycin C |