Azido-PEG8-CH2CO2-PFP
Modify Date: 2025-08-27 07:54:09
Azido-PEG8-CH2CO2-PFP structure
|
Common Name | Azido-PEG8-CH2CO2-PFP | ||
|---|---|---|---|---|
| CAS Number | 2182601-80-3 | Molecular Weight | 619.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H34F5N3O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG8-CH2CO2-PFPAzido-PEG8-CH2COO-PFP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG8-CH2COO-PFP |
|---|
| Description | Azido-PEG8-CH2COO-PFP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C24H34F5N3O10 |
|---|---|
| Molecular Weight | 619.53 |
| InChIKey | JAGMBOXHJXUFJS-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |