m-PEG5-CH2CH2COOH structure
|
Common Name | m-PEG5-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 1347750-72-4 | Molecular Weight | 324.367 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 431.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5±22.2 °C | |
Use of m-PEG5-CH2CH2COOHm-PEG5-CH2CH2COOH is a PEG-based based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 2,5,8,11,14,17-Hexaoxaicosan-20-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG5-CH2CH2COOH is a PEG-based based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
[1]. Parva Yogeshchandra Purohit, et al. Prodrugs of fulvestrant. WO2019224790A2. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.5±45.0 °C at 760 mmHg |
| Molecular Formula | C14H28O8 |
| Molecular Weight | 324.367 |
| Flash Point | 148.5±22.2 °C |
| Exact Mass | 324.178406 |
| LogP | -2.07 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | YMWMTQPDLHRNCZ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCC(=O)O |
| Hazard Codes | Xi |
|---|
| 2,5,8,11,14,17-Hexaoxaicosan-20-oic acid |
| MFCD20926383 |
| 2,5,8,11,14,17-Hexaoxaeicosan-20-oic acid |