N-Boc-cis-4-Hydroxy-D-proline structure
|
Common Name | N-Boc-cis-4-Hydroxy-D-proline | ||
|---|---|---|---|---|
| CAS Number | 135042-12-5 | Molecular Weight | 231.246 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 390.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO5 | Melting Point | 145ºC | |
| MSDS | Chinese USA | Flash Point | 190.2±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-Boc-cis-4-Hydroxy-D-prolineN-Boc-cis-4-Hydroxy-D-proline is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). N-Boc-cis-4-Hydroxy-D-proline is also a alkyl chain-based PROTAC linker that can be used in the synth |
| Name | Boc-Cis-4-Hydroxy-D-Proline |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-cis-4-Hydroxy-D-proline is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). N-Boc-cis-4-Hydroxy-D-proline is also a alkyl chain-based PROTAC linker that can be used in the synth |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.9±42.0 °C at 760 mmHg |
| Melting Point | 145ºC |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.246 |
| Flash Point | 190.2±27.9 °C |
| Exact Mass | 231.110672 |
| PSA | 87.07000 |
| LogP | -0.71 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | BENKAPCDIOILGV-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(O)CC1C(=O)O |
| Storage condition | 2-8°C |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2R,4R)-1-(tert-Butoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) ester, (2S,4S)- |
| N-Boc-cis-4-Hydroxy-D-proline |
| (4S)-4-Hydroxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-proline |
| (4R)-4-Hydroxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-proline |
| (2R,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| (2R,4R)-N-Boc-4-hydroxy-2-pyrrolidinecarboxylic acid |
| MFCD02094407 |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) ester, (2R,4R)- |