3,7-Di-O-methylducheside A structure
|
Common Name | 3,7-Di-O-methylducheside A | ||
|---|---|---|---|---|
| CAS Number | 136133-08-9 | Molecular Weight | 476.39 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 804.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H20O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.0±27.8 °C | |
Use of 3,7-Di-O-methylducheside A3, 7-di-o-methylducheside A (Compound 2) is a ethyl acetate extract of Psittacanthus cucullaris. 3, 7-di-o-methylducheside A stimulates the formation of glycosaminoglycan chains. 3, 7-di-o-methylducheside A can be used to study the rate of glycosaminoglycan synthesis [1]. |
| Name | 3,7,8-Trimethoxy-5,10-dioxo-5,10-dihydrochromeno[5,4,3-cde]chrome n-2-yl β-D-xylopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | 3, 7-di-o-methylducheside A (Compound 2) is a ethyl acetate extract of Psittacanthus cucullaris. 3, 7-di-o-methylducheside A stimulates the formation of glycosaminoglycan chains. 3, 7-di-o-methylducheside A can be used to study the rate of glycosaminoglycan synthesis [1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Sinha A, et al. Glycoside primers of Psittacanthus cucullaris. J Nat Prod. 1999 Jul;62(7):1036-8. |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 804.2±65.0 °C at 760 mmHg |
| Molecular Formula | C22H20O12 |
| Molecular Weight | 476.39 |
| Flash Point | 283.0±27.8 °C |
| Exact Mass | 476.095490 |
| PSA | 167.26000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | QXQRDKINPINYFD-SCBIHCBJSA-N |
| SMILES | COc1cc2c(=O)oc3c(OC)c(OC4OCC(O)C(O)C4O)cc4c(=O)oc(c1OC)c2c34 |
| Hazard Codes | Xi |
|---|
| 3,7,8-Trimethoxy-5,10-dioxo-5,10-dihydrochromeno[5,4,3-cde]chromen-2-yl β-D-xylopyranoside |
| [1]Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 2,3,8-trimethoxy-7-(β-D-xylopyranosyloxy)- |