MNK1/2-IN-5 structure
|
Common Name | MNK1/2-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 1426928-20-2 | Molecular Weight | 308.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MNK1/2-IN-5MNK1/2-IN-5 is a potent and selective MNK1/2 inhibitor as a therapeutic agent. |
| Name | MNK1/2-IN-5 |
|---|
| Description | MNK1/2-IN-5 is a potent and selective MNK1/2 inhibitor as a therapeutic agent. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H16N4O2 |
|---|---|
| Molecular Weight | 308.33 |
| InChIKey | CMDIADSAZCFCCT-LLVKDONJSA-N |
| SMILES | CC(CN)Oc1ccc2ncc(-c3cc4ccccc4o3)n2n1 |