Mal-PEG2-NHS ester structure
|
Common Name | Mal-PEG2-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1433997-01-3 | Molecular Weight | 354.312 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 524.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C15H18N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.9±32.9 °C | |
Use of Mal-PEG2-NHS esterMal-PEG2-NHS ester is a nonclaevable ADC linker containing a Maleimide group, 2-unit PEG and an NHS ester. |
| Name | 1-[2-(2-{3-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy}ethoxy)ethyl]-1H-pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-PEG2-NHS ester is a nonclaevable ADC linker containing a Maleimide group, 2-unit PEG and an NHS ester. |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 524.3±60.0 °C at 760 mmHg |
| Molecular Formula | C15H18N2O8 |
| Molecular Weight | 354.312 |
| Flash Point | 270.9±32.9 °C |
| Exact Mass | 354.106323 |
| LogP | -2.25 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | KMEJZQCDHANYJV-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| 1-[2-(2-{3-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy}ethoxy)ethyl]-1H-pyrrole-2,5-dione |
| MFCD24539465 |
| 1H-Pyrrole-2,5-dione, 1-[2-[2-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]ethoxy]ethyl]- |