Xanthosine structure
|
Common Name | Xanthosine | ||
|---|---|---|---|---|
| CAS Number | 146-80-5 | Molecular Weight | 284.225 | |
| Density | 2.3±0.1 g/cm3 | Boiling Point | 828.2±75.0 °C at 760 mmHg | |
| Molecular Formula | C10H12N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 454.7±37.1 °C | |
Use of XanthosineXanthosine is a nucleoside derived from xanthine and ribose. |
| Name | xanthosine |
|---|---|
| Synonym | More Synonyms |
| Description | Xanthosine is a nucleoside derived from xanthine and ribose. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| Density | 2.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 828.2±75.0 °C at 760 mmHg |
| Molecular Formula | C10H12N4O6 |
| Molecular Weight | 284.225 |
| Flash Point | 454.7±37.1 °C |
| Exact Mass | 284.075684 |
| PSA | 153.46000 |
| LogP | -2.43 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.925 |
| InChIKey | UBORTCNDUKBEOP-UUOKFMHZSA-N |
| SMILES | O=c1[nH]c(=O)c2ncn(C3OC(CO)C(O)C3O)c2[nH]1 |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~79%
Xanthosine CAS#:146-80-5 |
| Literature: Nagano, Tetsuo; Takizawa, Hiromasa; Hirobe, Masaaki Tetrahedron Letters, 1995 , vol. 36, # 45 p. 8239 - 8242 |
|
~44%
Xanthosine CAS#:146-80-5 |
| Literature: Tetrahedron Letters, , vol. 39, # 40 p. 7397 - 7400 |
|
~%
Xanthosine CAS#:146-80-5 |
| Literature: Tetrahedron, , vol. 56, # 40 p. 7909 - 7914 |
|
~%
Xanthosine CAS#:146-80-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 11, # 21 p. 2937 - 2941 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Xanthine riboside |
| 9-b-D-Ribofuranosyl-9H-purine-2,6-diol |
| 2,3-Dihydroxanthosine |
| MFCD00005726 |
| 9-β-D-Ribofuranosylxanthine |
| Xanthosine |
| 9-b-D-Ribofuranosyl-9H-purine-2,6(1H,3H)-dione |
| EINECS 205-679-9 |
| Xanthosine Dihydrate |
| β-D-Ribofuranoside, xanthine-9 |
| 9-D-Ribofuranosylxanthine |
| 3,9-Dihydro-9-b-D-ribofuranosyl-1H-purine-2,6-dione |
| 9-(β-D-Ribofuranosyl)-3,9-dihydro-1H-purin-2,6-dion |
| 9-b-D-Ribofuranosyl Xanthine |
| 9-b-D-Ribofuranosylxanthine |
| 9-β-δ-Ribofuranosylxanthine |