H-D-Trp-OMe.HCl structure
|
Common Name | H-D-Trp-OMe.HCl | ||
|---|---|---|---|---|
| CAS Number | 14907-27-8 | Molecular Weight | 254.713 | |
| Density | N/A | Boiling Point | 390.6ºC at 760mmHg | |
| Molecular Formula | C12H15ClN2O2 | Melting Point | 213-216ºC | |
| MSDS | Chinese USA | Flash Point | 190ºC | |
| Name | D-Tryptophan methyl ester hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 390.6ºC at 760mmHg |
|---|---|
| Melting Point | 213-216ºC |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.713 |
| Flash Point | 190ºC |
| Exact Mass | 254.082199 |
| PSA | 68.11000 |
| LogP | 2.71300 |
| Vapour Pressure | 2.62E-06mmHg at 25°C |
| Index of Refraction | -19 ° (C=5, MeOH) |
| InChIKey | XNFNGGQRDXFYMM-HNCPQSOCSA-N |
| SMILES | COC(=O)C(N)Cc1c[nH]c2ccccc12.Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
H-D-Trp-OMe.HCl CAS#:14907-27-8 |
| Literature: WO2010/148191 A2, ; Page/Page column 45-49; 59 ; |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Inhibition of indoleamine 2,3-dioxygenase activity by levo-1-methyl tryptophan blocks gamma interferon-induced Chlamydia trachomatis persistence in human epithelial cells.
Infect. Immun. 79 , 4425-4437, (2011) Gamma interferon (IFN-γ) induces expression of the tryptophan-catabolizing enzyme indoleamine 2,3-dioxygenase (IDO1) in human epithelial cells, the permissive cells for the obligate intracellular bact... |
|
|
Mouse model for allogeneic immune reaction against fetus recapitulates human pre-eclampsia.
J. Obstet. Gynaecol. Res. 34(1) , 1-6, (2008) We have previously demonstrated that mRNA expression and enzyme activity levels of placental indoleamine 2,3-dioxygenase (IDO), which degrades L-tryptophan and blocks the proliferation of T cells, are... |
|
|
Abnormal brain tryptophan metabolism and clinical correlates in Tourette syndrome.
Mov. Disord 22(15) , 2256-62, (2007) Symptoms in Tourette syndrome (TS) are likely related to abnormalities involving multiple neurotransmitter systems in striatal-thalamo-cortical circuitry. Although prior studies have found abnormal le... |
| MFCD00038992 |
| Methyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate hydrochloride |
| Methyl D-tryptophanate hydrochloride |
| T56 BMJ D1YZVO1 &&D or R Form HCl |
| D-Tryptophan, methyl ester, hydrochloride (1:1) |
| Methyl D-tryptophanate hydrochloride (1:1) |
| H-D-Trp-OMe·HCl |
| Methyl (R)-2-amino-3-(1H-indol-3-yl)propanoate hydrochloride |
| D-Tryptophanmethyl ester hydrochloride |
| EINECS 231-385-5 |
| H-D-Trp-Ome.HCl |
| (R)-Methyl 2-amino-3-(1H-indol-3-yl)propanoate hydrochloride |
| methyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate,hydrochloride |
| D-Tryptophan methyl ester hydrochloride |
| D-Tryptophan methylester hydrochloride salt |