N,N-Dimethyl-1-(4-nitrophenyl)methanamine structure
|
Common Name | N,N-Dimethyl-1-(4-nitrophenyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 15184-96-0 | Molecular Weight | 180.204 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 262.4±15.0 °C at 760 mmHg | |
| Molecular Formula | C9H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.5±20.4 °C | |
| Name | N,N-dimethyl-1-(4-nitrophenyl)methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 262.4±15.0 °C at 760 mmHg |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.204 |
| Flash Point | 112.5±20.4 °C |
| Exact Mass | 180.089874 |
| PSA | 49.06000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | ZRLVPQKSXHTXMN-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921499090 |
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-nitro-N,N-dimethylbenzylamine |
| 4-(dimethylamino-methyl)-nitrobenzene |
| dimethyl[(4-nitrophenyl)methyl]amine |
| dimethyl-4-nitrobenzylamine |
| Benzenemethanamine, N,N-dimethyl-4-nitro- |
| (p-dimethylaminomethyl)nitrobenzene |
| N,N-Dimethyl-1-(4-nitrophenyl)methanamine |
| N,N-dimethyl-4-nitrobenzylamine |
| n,n-dimethyl(4-nitrophenyl)methanamine |