Penicillin G benzathine structure
|
Common Name | Penicillin G benzathine | ||
|---|---|---|---|---|
| CAS Number | 1538-09-6 | Molecular Weight | 909.124 | |
| Density | N/A | Boiling Point | 663.3ºCat 760 mmHg | |
| Molecular Formula | C48H56N6O8S2 | Melting Point | 123-124ºC | |
| MSDS | Chinese USA | Flash Point | 355ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
Use of Penicillin G benzathinePenicillin G benzathine (Benzathine benzylpenicillin) is an antibiotic against many bacterial infections[1]. |
| Name | benzylpenicillin benzathine |
|---|---|
| Synonym | More Synonyms |
| Description | Penicillin G benzathine (Benzathine benzylpenicillin) is an antibiotic against many bacterial infections[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 663.3ºCat 760 mmHg |
|---|---|
| Melting Point | 123-124ºC |
| Molecular Formula | C48H56N6O8S2 |
| Molecular Weight | 909.124 |
| Flash Point | 355ºC |
| Exact Mass | 908.360107 |
| PSA | 248.08000 |
| LogP | 5.72700 |
| Vapour Pressure | 1.69E-18mmHg at 25°C |
| InChIKey | BVGLIYRKPOITBQ-ANPZCEIESA-N |
| SMILES | CC1(C)SC2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)O.CC1(C)SC2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)O.c1ccc(CNCCNCc2ccccc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H334 |
| Precautionary Statements | P261-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
| RTECS | XH9425000 |
|
Treatment of late-stage syphilis--reply.
JAMA 313(9) , 969-70, (2015)
|
|
|
Treatment of late-stage syphilis.
JAMA 313(9) , 968-9, (2015)
|
|
|
Clinical features and incidence rates of ocular complications in patients with ocular syphilis.
Am. J. Ophthalmol. 159(2) , 334-43.e1, (2015) To describe the clinical outcomes of ocular syphilis.Retrospective chart review.The charts of patients with ocular syphilis (regardless of human immunodeficiency virus [HIV] status) seen in a uveitis ... |
| leomypen |
| neolin |
| dibencil |
| 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-, (2S,5R,6R)-, compd. with N,N-bis(phenylmethyl)-1,2-ethanediamine (2:1) |
| benzathine benzylpenicillin |
| (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid - N,N'-dibenzylethane-1,2-diamine (2:1) |
| benzapen |
| moldamin |
| N,N'-Dibenzylethylenedi amine bis[benzylpenicillin] |
| Megacillin |
| pendepon |
| DBED-penicillin |
| Penicillin G N,N'-dibenzylethylenediamine salt |
| [2S-(2a,5a,6b)]-3,3-Dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid compd with N,N'-bis(phenylmethyl)-1,2-ethanediamine (2:1) |
| cillenta |
| N,N'-Dibenzyl-1,2-ethanediaminium bis{(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate} |
| penadur |
| Benzathine Penicillin G |
| bicillin |
| longicil |