TYRPHOSTIN AG 1290 structure
|
Common Name | TYRPHOSTIN AG 1290 | ||
|---|---|---|---|---|
| CAS Number | 160391-70-8 | Molecular Weight | 250.164 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 478.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4±28.7 °C | |
Use of TYRPHOSTIN AG 1290Entacapone acid (Tyrphostin AG1290) is a tyrosine kinase inhibitor. Entacapone acid reduces hepatic protein synthesis rate (HPS) in vivo[1]. |
| Name | (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Entacapone acid (Tyrphostin AG1290) is a tyrosine kinase inhibitor. Entacapone acid reduces hepatic protein synthesis rate (HPS) in vivo[1]. |
|---|---|
| Related Catalog | |
| Target |
Tyrosine kinase[1] |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.9±45.0 °C at 760 mmHg |
| Molecular Formula | C10H6N2O6 |
| Molecular Weight | 250.164 |
| Flash Point | 243.4±28.7 °C |
| Exact Mass | 250.022583 |
| PSA | 147.37000 |
| LogP | 2.19 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.750 |
| InChIKey | XDDDOLQEZBJWFZ-LZCJLJQNSA-N |
| SMILES | N#CC(=Cc1cc(O)c(O)c([N+](=O)[O-])c1)C(=O)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| unii-3u917c92qr |
| (2E)-2-Cyano-3-(3,4-dihydroxy-5-nitrophenyl)acrylic acid |
| ss-3041 |
| 2-Propenoic acid, 2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-, (2E)- |