PF-06256142 structure
|
Common Name | PF-06256142 | ||
|---|---|---|---|---|
| CAS Number | 1609583-14-3 | Molecular Weight | 356.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF-06256142PF-06256142 is a potent and selective orthosteric agonist of the D1 receptor, with D1 EC50=30 nM and D1 binding Ki = 12 nM. |
| Name | PF-06256142 |
|---|
| Description | PF-06256142 is a potent and selective orthosteric agonist of the D1 receptor, with D1 EC50=30 nM and D1 binding Ki = 12 nM. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H16N4O2 |
|---|---|
| Molecular Weight | 356.38 |
| InChIKey | HWAIAGZSWHOLLK-UHFFFAOYSA-N |
| SMILES | Cc1cc(Oc2nccc3occc23)ccc1-c1c(C)ncc2nccn12 |