PF-03463275
Modify Date: 2025-09-10 12:35:31
PF-03463275 structure
|
Common Name | PF-03463275 | ||
|---|---|---|---|---|
| CAS Number | 1173177-11-1 | Molecular Weight | 413 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22ClFN4O.2(HCl) | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF-03463275PF-03463275 (PF 3463275) ia an orally bioavailable, centrally penetrant, potent, reversible, selective, and competitive inhibitor of the human GlyT1 transporter with Ki of 13 nM. |
| Name | N-[(3-Chloro-4-fluorophenyl)methyl]-1-methyl-N-[[(1alpha,5alpha,6alpha)-3-methyl-3-azabicyclo[3.1.0]hex-6-yl]methyl]-1H-imidazole-4-carboxamide hydrochloride |
|---|
| Molecular Formula | C19H22ClFN4O.2(HCl) |
|---|---|
| Molecular Weight | 413 |
| InChIKey | BHPFPDLKIFJVQN-XQSJJHPKSA-N |
| SMILES | CN1CC2C(C1)C2CN(Cc1ccc(F)c(Cl)c1)C(=O)c1cn(C)cn1.Cl.Cl |