CXCR7 antagonist-1 structure
|
Common Name | CXCR7 antagonist-1 | ||
|---|---|---|---|---|
| CAS Number | 1613021-99-0 | Molecular Weight | 390.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19FN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CXCR7 antagonist-1CXCR7 antagonist-1 is an inhibitor of the binding of the SDF-1 chemokine (CXCL12 chemokine) or I-TAC (CXCL11) to the chemokine receptor CXCR. CXCR7 antagonist-1 prevents tumor cell proliferation, tumor formation, inflammatory diseases, and many other diseases (extracted from patent WO2014085490A1, compound 1.128)[1]. |
| Name | CXCR7 antagonist-1 |
|---|
| Description | CXCR7 antagonist-1 is an inhibitor of the binding of the SDF-1 chemokine (CXCL12 chemokine) or I-TAC (CXCL11) to the chemokine receptor CXCR. CXCR7 antagonist-1 prevents tumor cell proliferation, tumor formation, inflammatory diseases, and many other diseases (extracted from patent WO2014085490A1, compound 1.128)[1]. |
|---|---|
| Related Catalog | |
| Target |
CXCR7 |
| References |
[1]. Junfa Fan, et al. Cxcr7 antagonists. Patent WO2014085490A1. |
| Molecular Formula | C21H19FN6O |
|---|---|
| Molecular Weight | 390.41 |
| InChIKey | IGJCDMUXCOCMMI-INIZCTEOSA-N |
| SMILES | O=C(NC1CCN(c2nccn3cccc23)C1)c1ccn(-c2ccc(F)cc2)n1 |
| Storage condition | -20°C |