Lipoamido-PEG2-OH structure
|
Common Name | Lipoamido-PEG2-OH | ||
|---|---|---|---|---|
| CAS Number | 1674386-82-3 | Molecular Weight | 337.499 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 546.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H27NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.3±25.9 °C | |
Use of Lipoamido-PEG2-OHLipoamido-PEG2-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Lipoamido-PEG2-alcohol |
|---|---|
| Synonym | More Synonyms |
| Description | Lipoamido-PEG2-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 546.5±35.0 °C at 760 mmHg |
| Molecular Formula | C14H27NO4S2 |
| Molecular Weight | 337.499 |
| Flash Point | 284.3±25.9 °C |
| Exact Mass | 337.138153 |
| LogP | 0.47 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | VTTNIUWBGVLVEK-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC1CCSS1)NCCOCCOCCO |
| LIPOAMIDO-PEG2-OH |