Lipoamido-PEG3-OH structure
|
Common Name | Lipoamido-PEG3-OH | ||
|---|---|---|---|---|
| CAS Number | 1342764-64-0 | Molecular Weight | 381.551 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 573.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C16H31NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.8±27.3 °C | |
Use of Lipoamido-PEG3-OHLipoamido-PEG3-OH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Lipoamido-PEG3-OH (compound TA-TEG-G2CN) can be used in the formation of a highly stable, dendronized gold nanoparticle (AuNP)-based drug delivery platform[1]. |
| Name | Lipoamido-PEG3-alcohol |
|---|---|
| Synonym | More Synonyms |
| Description | Lipoamido-PEG3-OH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Lipoamido-PEG3-OH (compound TA-TEG-G2CN) can be used in the formation of a highly stable, dendronized gold nanoparticle (AuNP)-based drug delivery platform[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.8±40.0 °C at 760 mmHg |
| Molecular Formula | C16H31NO5S2 |
| Molecular Weight | 381.551 |
| Flash Point | 300.8±27.3 °C |
| Exact Mass | 381.164368 |
| LogP | 0.12 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | RCNNKKYGPYWQAT-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC1CCSS1)NCCOCCOCCOCCO |
| Storage condition | 2-8°C |
| LIPOAMIDO-PEG3-OH |