o,o'-bis(trimethylsilyl)-5-fluorouracil structure
|
Common Name | o,o'-bis(trimethylsilyl)-5-fluorouracil | ||
|---|---|---|---|---|
| CAS Number | 17242-85-2 | Molecular Weight | 274.43900 | |
| Density | 1,05 g/cm3 | Boiling Point | 114°C 14mm | |
| Molecular Formula | C10H19FN2O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 32°C | |
| Name | (5-fluoro-2-trimethylsilyloxypyrimidin-4-yl)oxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1,05 g/cm3 |
|---|---|
| Boiling Point | 114°C 14mm |
| Molecular Formula | C10H19FN2O2Si2 |
| Molecular Weight | 274.43900 |
| Flash Point | 32°C |
| Exact Mass | 274.09700 |
| PSA | 44.24000 |
| LogP | 3.04310 |
| Vapour Pressure | 0.0142mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | MPVQFVDWJDULDL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1ncc(F)c(O[Si](C)(C)C)n1 |
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | R10;R20/21/22 |
| Safety Phrases | S36/37 |
| RIDADR | 1992 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2933599090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-fluoro-2,4-bis(trimethylsilyloxy)pyrimidine |
| MFCD00042441 |
| 2,4-di-(trimethylsilyloxy)-5-fluoropyrimidine |
| 2,4-Bis(trimethylsilyl)-5-fluorouracil |
| Uracil,5-fluoro,TMS |
| 5-Fluorouracil,TMS |
| O,O'-bis(TMS)-5-fluorouracil |
| PC1258 |
| 2,4-bis(trimethylsilyloxy)-5-fluoropyrimidine |