Bromoacetamide-PEG3-C1-acid structure
|
Common Name | Bromoacetamide-PEG3-C1-acid | ||
|---|---|---|---|---|
| CAS Number | 173323-22-3 | Molecular Weight | 328.15700 | |
| Density | 1.449g/cm3 | Boiling Point | 539.5ºC at 760mmHg | |
| Molecular Formula | C10H18BrNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.1ºC | |
Use of Bromoacetamide-PEG3-C1-acidBromoacetamide-PEG3-C1-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Bromoacetamide-PEG3-C1-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1] |
| References |
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 539.5ºC at 760mmHg |
| Molecular Formula | C10H18BrNO6 |
| Molecular Weight | 328.15700 |
| Flash Point | 280.1ºC |
| Exact Mass | 327.03200 |
| PSA | 97.58000 |
| LogP | 0.47220 |
| Vapour Pressure | 4.51E-13mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | YTQSICXMSXKITM-UHFFFAOYSA-N |
| SMILES | O=C(O)COCCOCCOCCNC(=O)CBr |
| 14-Bromo-13-oxo-3,6,9-trioxa-12-azatetradecan-1-oic acid |
| Tatdabo |
| OR8462 |