2-[3-(Trifluoromethyl)benzoyl]aminoacetic acid structure
|
Common Name | 2-[3-(Trifluoromethyl)benzoyl]aminoacetic acid | ||
|---|---|---|---|---|
| CAS Number | 17794-48-8 | Molecular Weight | 247.17100 | |
| Density | 1.417g/cm3 | Boiling Point | 401.7ºC at 760mmHg | |
| Molecular Formula | C10H8F3NO3 | Melting Point | 134-138ºC | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | 2-[[3-(trifluoromethyl)benzoyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 401.7ºC at 760mmHg |
| Melting Point | 134-138ºC |
| Molecular Formula | C10H8F3NO3 |
| Molecular Weight | 247.17100 |
| Flash Point | 196.7ºC |
| Exact Mass | 247.04600 |
| PSA | 66.40000 |
| LogP | 1.91070 |
| Vapour Pressure | 3.57E-07mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | ZDGGJQMSELMHLK-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)c1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
|
~92%
2-[3-(Trifluoro... CAS#:17794-48-8 |
| Literature: Zhang, Xuqing; Hufnagel, Heather Rae; Hou, Cuifen; Johnson, Dana L.; Sui, Zhihua; Fegely, Barry; Breslin, David Patent: US2010/144695 A1, 2010 ; Location in patent: Page/Page column 61-62 ; US 20100144695 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00029782 |
| m-trifluoromethylhippuric acid |
| 2-{[3-(Trifluoromethyl)benzoyl]amino}acetic acid |
| N-(3-(TRIFLUOROMETHYL)BENZOYL)GLYCINE |