DBCO-PEG4-amine structure
|
Common Name | DBCO-PEG4-amine | ||
|---|---|---|---|---|
| CAS Number | 1840886-10-3 | Molecular Weight | 523.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H37N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DBCO-PEG4-amineDBCO-PEG4-amine is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). DBCO-PEG4-amine can be used in the synthesis of FPM-PEG4-DBCO (a homobifunctional azide-to-azide cross-linker)[1]. |
| Name | DBCO-PEG4-amine |
|---|
| Description | DBCO-PEG4-amine is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). DBCO-PEG4-amine can be used in the synthesis of FPM-PEG4-DBCO (a homobifunctional azide-to-azide cross-linker)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C29H37N3O6 |
|---|---|
| Molecular Weight | 523.62 |
| InChIKey | NFJQULPXXATMFO-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCOCCOCCNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| Storage condition | -20°C |