methyl 5-nitro-2-furoate structure
|
Common Name | methyl 5-nitro-2-furoate | ||
|---|---|---|---|---|
| CAS Number | 1874-23-3 | Molecular Weight | 171.10800 | |
| Density | 1.402g/cm3 | Boiling Point | 284.3ºC at 760 mmHg | |
| Molecular Formula | C6H5NO5 | Melting Point | 78-82 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 125.7ºC | |
| Name | methyl 5-nitrofuran-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 284.3ºC at 760 mmHg |
| Melting Point | 78-82 °C(lit.) |
| Molecular Formula | C6H5NO5 |
| Molecular Weight | 171.10800 |
| Flash Point | 125.7ºC |
| Exact Mass | 171.01700 |
| PSA | 85.26000 |
| LogP | 1.49760 |
| Vapour Pressure | 0.003mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | UTLKCGPAJUYGOM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])o1 |
| Storage condition | 2-8℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | LV2013000 |
| HS Code | 2932190090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Reduction of methyl 5-nitro-2-furoate by xanthine oxidase: an evidence for hydroxylaminofuran formation.
Chem. Pharm. Bull. 30(7) , 2647-50, (1982)
|
|
|
Formation of novel nitrofuran metabolites in xanthine oxidase-catalyzed reduction of methyl 5-nitro-2-furoate.
Arch. Biochem. Biophys. 232(1) , 234-9, (1984) After methyl 5-nitro-2-furoate was incubated with milk xanthine oxidase, three reduction products were isolated from the incubation mixture. Among them, two reduction products were new types of nitrof... |
|
|
Yaws CL.
The Yaws Handbook of Physical Properties for Hydrocarbons and Chemicals 2nd ed.,, (2015), 97
|
| Methyl nitrofuroate |
| Methyl 5-nitrofuroate |
| 5-nitro-2-furanocarboxylic acid methyl ester |
| MFCD00051956 |
| methyl 5-nitro-2-furanoate |
| Methyl 5-nitro-2-furoate |
| Methyl 5-nitro-2-furancarboxylate |
| 5-Nitro-2-furancarboxylic acid methyl ester |
| Methyl 5-nitropyromucate |
| methyl 5-nitofuran-2-carboxylate |