Ald-Ph-PEG6-t-butyl ester structure
|
Common Name | Ald-Ph-PEG6-t-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 2055013-49-3 | Molecular Weight | 541.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H43NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ald-Ph-PEG6-t-butyl esterAld-Ph-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Ald-Ph-PEG6-Boc |
|---|---|
| Synonym | More Synonyms |
| Description | Ald-Ph-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C27H43NO10 |
|---|---|
| Molecular Weight | 541.63 |
| InChIKey | DODVDQNRIUQKOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCNC(=O)c1ccc(C=O)cc1 |
| MFCD28155204 |