Mal-NH-PEG8-CH2CH2COOPFP ester structure
|
Common Name | Mal-NH-PEG8-CH2CH2COOPFP ester | ||
|---|---|---|---|---|
| CAS Number | 2055023-14-6 | Molecular Weight | 758.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H43F5N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-NH-PEG8-CH2CH2COOPFP esterMal-NH-PEG8-CH2CH2COOPFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Mal-NH-PEG8-CH2CH2COOPFP ester |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-NH-PEG8-CH2CH2COOPFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C32H43F5N2O13 |
|---|---|
| Molecular Weight | 758.68 |
| InChIKey | FEGJRGANWNMURJ-UHFFFAOYSA-N |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| Hazard Codes | Xi |
|---|
| MFCD28385471 |