t-Boc-N-amido-PEG5-NHS ester structure
|
Common Name | t-Boc-N-amido-PEG5-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 2055040-78-1 | Molecular Weight | 506.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H38N2O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of t-Boc-N-amido-PEG5-NHS esterBoc-N-PEG5-C2-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | Boc-N-PEG5-C2-NHS ester |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-N-PEG5-C2-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C22H38N2O11 |
|---|---|
| Molecular Weight | 506.54 |
| InChIKey | FCVPAOUCTNORCY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |
| MFCD29764335 |