Boc-NH-PEG7-NH2 structure
|
Common Name | Boc-NH-PEG7-NH2 | ||
|---|---|---|---|---|
| CAS Number | 206265-98-7 | Molecular Weight | 468.58200 | |
| Density | 1.075g/cm3 | Boiling Point | 547.7ºC at 760 mmHg | |
| Molecular Formula | C21H44N2O9 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 285ºC | |
Use of Boc-NH-PEG7-NH2Boc-NH-PEG7-NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | tert-butyl N-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG7-NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.075g/cm3 |
|---|---|
| Boiling Point | 547.7ºC at 760 mmHg |
| Molecular Formula | C21H44N2O9 |
| Molecular Weight | 468.58200 |
| Flash Point | 285ºC |
| Exact Mass | 468.30500 |
| PSA | 128.96000 |
| LogP | 1.67720 |
| Vapour Pressure | 4.75E-12mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | HTIMIYPOESODPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCN |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Boc-NH-PEG7-CH2CH2NH2 |
| 25-Amino-5,8,11,14,17,20,23-heptaoxa-2-azapentacosanoic Acid1,1-Dimethylethyl Ester |