Boc-NH-PEG7-acetic acid
Modify Date: 2024-02-03 16:31:13
Boc-NH-PEG7-acetic acid structure
|
Common Name | Boc-NH-PEG7-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 141282-29-3 | Molecular Weight | 483.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H41NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-NH-PEG7-acetic acidBoc-NH-PEG7-acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Boc-NH-PEG7-acetic acid |
|---|
| Description | Boc-NH-PEG7-acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C21H41NO11 |
|---|---|
| Molecular Weight | 483.55 |
| InChIKey | JZVPPASVRSYVSR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCC(=O)O |