Rp-8-pCPT-cGMPS sodium structure
|
Common Name | Rp-8-pCPT-cGMPS sodium | ||
|---|---|---|---|---|
| CAS Number | 208445-07-2 | Molecular Weight | 525.859 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14ClN5NaO6PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rp-8-pCPT-cGMPS sodiumRp-8-pCPT-Cyclic GMPS sodium salt is a stable, cell-permeable cGMP analog that competitively inhibits cGMP-dependent protein kinases (cGKs), including cGK Iα and cGK II (IC50s, 18.3 and 0.16 M, respectively). |
| Name | Rp-8-pCPT-Cyclic GMPS (sodium salt) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14ClN5NaO6PS2 |
|---|---|
| Molecular Weight | 525.859 |
| Exact Mass | 524.970947 |
| InChIKey | JERAACMSJYSCBY-UHFFFAOYSA-M |
| SMILES | Nc1nc2c(nc(Sc3ccc(Cl)cc3)n2C2OC3COP([O-])(=S)OC3C2O)c(=O)[nH]1.[Na+] |
| Rp-8-pCPT-Cyclic GMPS (sodium salt) |
| 6H-Purin-6-one, 2-amino-8-[(4-chlorophenyl)thio]-1,9-dihydro-9-[(2R,4aR,6R,7R,7aS)-tetrahydro-7-hydroxy-2-mercapto-2-oxido-4H-furo[3,2-d]-1,3,2-dioxaphosphorin-6-yl]-, sodium salt (1:1) |
| Sodium (2R,4aR,6R,7R,7aS)-6-{2-amino-8-[(4-chlorophenyl)sulfanyl]-6-oxo-1,6-dihydro-9H-purin-9-yl}-7-hydroxytetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinine-2-thiolate 2-oxide |