2-Aminoadenosine structure
|
Common Name | 2-Aminoadenosine | ||
|---|---|---|---|---|
| CAS Number | 2096-10-8 | Molecular Weight | 282.26 | |
| Density | 2.3±0.1 g/cm3 | Boiling Point | 798.5±70.0 °C at 760 mmHg | |
| Molecular Formula | C10H14N6O4 | Melting Point | 241-243°C (dec.) | |
| MSDS | N/A | Flash Point | 436.7±35.7 °C | |
Use of 2-Aminoadenosine2-Aminoadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 9H-Purine-2,6-diamine, 9-.β.-D-ribofuranosyl |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Aminoadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 798.5±70.0 °C at 760 mmHg |
| Melting Point | 241-243°C (dec.) |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 |
| Flash Point | 436.7±35.7 °C |
| Exact Mass | 282.107666 |
| PSA | 165.56000 |
| LogP | -1.08 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.986 |
| InChIKey | ZDTFMPXQUSBYRL-UUOKFMHZSA-N |
| SMILES | Nc1nc(N)c2ncn(C3OC(CO)C(O)C3O)c2n1 |
| Storage condition | 2~8℃ |
| HS Code | 2942000000 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2942000000 |
|---|
| Aminoadenosine |
| 2,6-DiaMinopurinosine |
| 9-Pentofuranosyl-9H-purine-2,6-diamine |
| 2-AMINO-ADENOSINE |
| 2,6-DIAMINOPURINE RIBOSIDE |
| (2R,3R,4S,5R)-2-(2,6-Diamino-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydro-3,4-furandiol |
| 2-Amino-adenoside |
| 2-AMINE ADENOSINE |
| 2,6-Diamino-9-(β-D-ribofuranosyl)purine |
| MFCD00053556 |
| 2-Aminoadenosine |
| 9H-Purine-2,6-diamine, 9-β-D-ribofuranosyl- |
| 2,6-Diamino-9-(beta-D-ribofuranosyl)purine |
| 9-(β-D-Ribofuranosyl)-9H-purin-2,6-diamin |
| EINECS 209-610-8 |
| Adenosine, 2-amino- |
| 2,6-DiaMinonebularine |
| 9H-Purine-2,6-diamine, 9-pentofuranosyl- |
| 2-AMinoadenosin |
| purine-2,6-diamine ribonucleoside |
| 2-NH2-A |
| 2,6-DIAMINOPURINE-RIBOSIDE |