N-Boc-N-bis(PEG1-azide) structure
|
Common Name | N-Boc-N-bis(PEG1-azide) | ||
|---|---|---|---|---|
| CAS Number | 2100306-79-2 | Molecular Weight | 343.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25N7O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Boc-N-bis(PEG1-azide)N-Boc-N-bis(C2-PEG1-azide) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | N-Boc-N-bis(C2-PEG1-azide) |
|---|
| Description | N-Boc-N-bis(C2-PEG1-azide) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C13H25N7O4 |
|---|---|
| Molecular Weight | 343.38 |
| InChIKey | HGPOSUHEHQKFBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCOCCN=[N+]=[N-])CCOCCN=[N+]=[N-] |
| Hazard Codes | Xi |
|---|