N-(Biotin-PEG4)-N-bis(PEG4-acid) HCl structure
|
Common Name | N-(Biotin-PEG4)-N-bis(PEG4-acid) HCl | ||
|---|---|---|---|---|
| CAS Number | 2112731-49-2 | Molecular Weight | 959.150 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 1024.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C42H78N4O18S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 573.4±34.3 °C | |
Use of N-(Biotin-PEG4)-N-bis(PEG4-acid) HClN-(Biotin-PEG4)-N-bis(PEG4-acid) HCl salt is a PEG Linker. PEG Linkers may be useful in the development of antibody drug conjugates. |
| Name | 16-{16-Oxo-20-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-3,6,9,12-tetraoxa-15-azaicos-1-yl}-4,7,10,13,19,22,25,28-octaoxa-16-azahentriacontane-1,31-dioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 1024.5±65.0 °C at 760 mmHg |
| Molecular Formula | C42H78N4O18S |
| Molecular Weight | 959.150 |
| Flash Point | 573.4±34.3 °C |
| Exact Mass | 958.503174 |
| LogP | -6.43 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | UPHBIHBKUOLKFH-MRTVQABZSA-N |
| SMILES | Cl.O=C(O)CCOCCOCCOCCOCCN(CCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21)CCOCCOCCOCCOCCC(=O)O |
| 16-{16-Oxo-20-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-3,6,9,12-tetraoxa-15-azaicos-1-yl}-4,7,10,13,19,22,25,28-octaoxa-16-azahentriacontane-1,31-dioic acid |
| 4,7,10,13,19,22,25,28-Octaoxa-16-azahentriacontane-1,31-dioic acid, 16-[20-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-16-oxo-3,6,9,12-tetraoxa-15-azaeicos-1-yl]- |
| MFCD30723243 |