Propargyl-PEG4-CH2CO2-NHS structure
|
Common Name | Propargyl-PEG4-CH2CO2-NHS | ||
|---|---|---|---|---|
| CAS Number | 2144777-76-2 | Molecular Weight | 343.329 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 451.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7±31.5 °C | |
Use of Propargyl-PEG4-CH2CO2-NHSPropargyl-PEG4-CH2CO2-NHS is a PEG derivative containing a propargyl group and an NHS group. The hydrophilic PEG spacer increases solubility in aqueous media. This reagent has a terminal NHS ester and is an amine reactive reagent for derivatizing peptides, antibodies, amine coated surfaces etc. The propargyl group can be reacted with azide-bearing compounds or biomolecules via copper catalyzed azide-NHS ester Click Chemistry to yield a stable triazole linkage. |
| Name | 1-(3,6,9,12-Tetraoxapentadec-14-ynoyloxy)-2,5-pyrrolidinedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.3±55.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO8 |
| Molecular Weight | 343.329 |
| Flash Point | 226.7±31.5 °C |
| Exact Mass | 343.126709 |
| LogP | -2.19 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | GYEPTYINFCZLBX-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCC(=O)ON1C(=O)CCC1=O |
| 1-(3,6,9,12-Tetraoxapentadec-14-ynoyloxy)-2,5-pyrrolidinedione |
| 2,5-Pyrrolidinedione, 1-[(1-oxo-3,6,9,12-tetraoxapentadec-14-yn-1-yl)oxy]- |