Propargyl-PEG4-NHS ester structure
|
Common Name | Propargyl-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1428629-70-2 | Molecular Weight | 357.356 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 463.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H23NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.9±31.5 °C | |
Use of Propargyl-PEG4-NHS esterPropargyl-PEG4-NHS ester is a nonclaevable 4-unit PEG linker for antibody-drug-conjugation (ADC). |
| Name | 1-(4,7,10,13-Tetraoxahexadec-15-ynoyloxy)-2,5-pyrrolidinedione |
|---|---|
| Synonym | More Synonyms |
| Description | Propargyl-PEG4-NHS ester is a nonclaevable 4-unit PEG linker for antibody-drug-conjugation (ADC). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.1±55.0 °C at 760 mmHg |
| Molecular Formula | C16H23NO8 |
| Molecular Weight | 357.356 |
| Flash Point | 233.9±31.5 °C |
| Exact Mass | 357.142365 |
| LogP | -2.32 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | GRIZGOGILWMGRU-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Hazard Codes | Xi |
|---|
| 2,5-Pyrrolidinedione, 1-[(1-oxo-4,7,10,13-tetraoxahexadec-15-yn-1-yl)oxy]- |
| 1-(4,7,10,13-Tetraoxahexadec-15-ynoyloxy)-2,5-pyrrolidinedione |
| MFCD22380743 |
| Propargyl-PEG4-NHS ester |