Apelin 13 structure
|
Common Name | Apelin 13 | ||
|---|---|---|---|---|
| CAS Number | 217082-58-1 | Molecular Weight | 1550.829 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C69H111N23O16S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Apelin 13Apelin-13 is the endogenous ligand of the orphan G protein-coupled receptor APJ, activates APJ receptor with an EC50 value of 0.37 nM in CHO cells[1][2]. |
| Name | gln-arg-pro-arg-leu-ser-his-lys-gly-pro-met-pro-phe |
|---|---|
| Synonym | More Synonyms |
| Description | Apelin-13 is the endogenous ligand of the orphan G protein-coupled receptor APJ, activates APJ receptor with an EC50 value of 0.37 nM in CHO cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C69H111N23O16S |
| Molecular Weight | 1550.829 |
| Exact Mass | 1549.829956 |
| PSA | 653.27000 |
| LogP | -3.42 |
| Index of Refraction | 1.688 |
| InChIKey | XXCCRHIAIBQDPX-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)C1CCCN1C(=O)CNC(=O)C(CCCCN)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(N)=O)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)O |
| Storage condition | −20°C |
| Water Solubility | Soluble in PBS (pH 7.2) at approximately 10 mg/ml. |
| WGK Germany | 3 |
|---|
| APELIN-13 |
| L-Phenylalanine, L-glutaminyl-L-arginyl-L-prolyl-L-arginyl-L-leucyl-L-seryl-L-histidyl-L-lysylglycyl-L-prolyl-L-methionyl-L-prolyl- |
| Gln-Arg-Pro-Arg-Leu-Ser-His-Lys-Gly-Pro-Met-Pro-Phe ((2) Due to the presence of a Gln in N-terMinal position this peptide can contain the pyroglutaMic forM) |
| APELIN-13 (HUMAN,BOVINE,MOUSE,RAT) |
| Apelin-13,human,bovine,mouse,rat (2) |
| APELIN-13 (HUMAN,BOVINE) |
| L-Glutaminyl-L-arginyl-L-prolyl-L-arginyl-L-leucyl-L-seryl-L-histidyl-L-lysylglycyl-L-prolyl-L-methionyl-L-prolyl-L-phenylalanine |
| apelin-13 trifluoroacetate salt |
| QRPRLSHKGPMPF |
| PREPRO-65-77-APELIN |
| MFCD02094627 |