Azido-PEG5-CH2CO2-PFP structure
|
Common Name | Azido-PEG5-CH2CO2-PFP | ||
|---|---|---|---|---|
| CAS Number | 2144777-92-2 | Molecular Weight | 487.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22F5N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG5-CH2CO2-PFPAzido-PEG5-CH2CO2-PFP is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG5-CH2CO2-PFP |
|---|
| Description | Azido-PEG5-CH2CO2-PFP is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C18H22F5N3O7 |
|---|---|
| Molecular Weight | 487.38 |
| InChIKey | NITGTHWASXRERB-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| Storage condition | 2-8°C |