4-(4-Formylphenoxy)benzaldehyde structure
|
Common Name | 4-(4-Formylphenoxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2215-76-1 | Molecular Weight | 226.22700 | |
| Density | 1.233g/cm3 | Boiling Point | 386ºC at 760 mmHg | |
| Molecular Formula | C14H10O3 | Melting Point | 63-67ºC | |
| MSDS | Chinese USA | Flash Point | 173.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(4-formylphenoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 386ºC at 760 mmHg |
| Melting Point | 63-67ºC |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.22700 |
| Flash Point | 173.1ºC |
| Exact Mass | 226.06300 |
| PSA | 43.37000 |
| LogP | 3.10390 |
| Vapour Pressure | 3.66E-06mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | GXZZHLULZRMUQC-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(Oc2ccc(C=O)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36-43 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2912299000 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2912299000 |
|---|---|
| Summary | 2912299000. other cyclic aldehydes without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 4,4'-bisformyl-diphenyl ether |
| 4,4'-Oxydibenzaldehyde |
| 4,4'-diformylphenyl ether |
| Benzaldehyde,4,4'-oxybis |
| 4,4'-Diformyldiphenyl ether |