Thalidomide-O-amido-C8-NH2 hydrochloride structure
|
Common Name | Thalidomide-O-amido-C8-NH2 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2415263-07-7 | Molecular Weight | 494.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H31ClN4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-O-amido-C8-NH2 hydrochlorideThalidomide-O-amido-C8-NH2 hydrochloride, a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker, can be used in the synthesis of PROTACs[1]. |
| Name | Thalidomide-O-amido-C8-NH2 hydrochloride |
|---|
| Description | Thalidomide-O-amido-C8-NH2 hydrochloride, a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker, can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | Thalidomide-O-amido-C8-NH2 is a degron-linker (refer to Compound DL7-TL). The PROTAC linker is bound lo at least one targeting ligand. Degron-linker-targeting ligand, wherein the linker is covalently bound lo at least one degron and at least one targeting ligand, the degron is a compound capable of binding to an ubiquitin ligase such as an E3 ubiquitin ligase (e g, cereblon), and the targeting ligand is capable of binding to the targeted protein (s)[1]. |
| References |
| Molecular Formula | C23H31ClN4O6 |
|---|---|
| Molecular Weight | 494.97 |
| InChIKey | KPPZEDZTBDIUJN-UHFFFAOYSA-N |
| SMILES | Cl.NCCCCCCCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|