3,4-Dibromo-Mal-PEG2-amine TFA structure
|
Common Name | 3,4-Dibromo-Mal-PEG2-amine TFA | ||
|---|---|---|---|---|
| CAS Number | 2296708-07-9 | Molecular Weight | 500.06 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15Br2F3N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3,4-Dibromo-Mal-PEG2-amine TFA3,4-Dibromo-Mal-PEG2-amine TFA is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 3,4-Dibromo-Mal-PEG2-amine TFA |
|---|
| Description | 3,4-Dibromo-Mal-PEG2-amine TFA is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C12H15Br2F3N2O6 |
|---|---|
| Molecular Weight | 500.06 |
| InChIKey | MGVSSFASAOVDDG-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCN1C(=O)C(Br)=C(Br)C1=O.O=C(O)C(F)(F)F |