TRPA1-IN-1 structure
|
Common Name | TRPA1-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 2376824-92-7 | Molecular Weight | 412.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17ClN6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TRPA1-IN-1TRPA1-IN-1 is a potent, selective, and orally bioavailable TRPA1 small molecule antagonist. |
| Name | TRPA1-IN-1 |
|---|
| Description | TRPA1-IN-1 is a potent, selective, and orally bioavailable TRPA1 small molecule antagonist. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H17ClN6O3 |
|---|---|
| Molecular Weight | 412.83 |
| InChIKey | UGLQOTZNBCEHHB-GXTWGEPZSA-N |
| SMILES | Cn1cnc2ncn(Cc3nc(C4COC(c5ccc(Cl)cc5)C4)no3)c(=O)c21 |