SGLT1/2-IN-2 structure
|
Common Name | SGLT1/2-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2387812-73-7 | Molecular Weight | 452.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26F2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SGLT1/2-IN-2SGLT1/2-IN-2 demonstrates potent dual inhibitory activities (IC50 = 96 nM for SGLT1 and IC50 = 1.3 nM for SGLT2). |
| Name | SGLT1/2-IN-2 |
|---|
| Description | SGLT1/2-IN-2 demonstrates potent dual inhibitory activities (IC50 = 96 nM for SGLT1 and IC50 = 1.3 nM for SGLT2). |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H26F2O7 |
|---|---|
| Molecular Weight | 452.45 |
| InChIKey | LPRSLQSOVPNTKW-CLAROIROSA-N |
| SMILES | COc1cc(O)c(C2OC(CO)C(F)(F)C(O)C2O)cc1Cc1ccc2c(c1)CCCO2 |