2,2,2-Cryptand structure
|
Common Name | 2,2,2-Cryptand | ||
|---|---|---|---|---|
| CAS Number | 23978-09-8 | Molecular Weight | 376.488 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 513.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H36N2O6 | Melting Point | 68-71 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 144.2±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 513.1±45.0 °C at 760 mmHg |
| Melting Point | 68-71 °C(lit.) |
| Molecular Formula | C18H36N2O6 |
| Molecular Weight | 376.488 |
| Flash Point | 144.2±25.9 °C |
| Exact Mass | 376.257324 |
| PSA | 61.86000 |
| LogP | -1.34 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | AUFVJZSDSXXFOI-UHFFFAOYSA-N |
| SMILES | C1COCCN2CCOCCOCCN(CCO1)CCOCCOCC2 |
| Storage condition | 2-8°C |
| Water Solubility | soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | MP4750000 |
| HS Code | 2934999090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Rapid synthesis of a 5'-fluorinated oligodeoxy-nucleotide: a model antisense probe for use in imaging with positron emission tomography (PET).
Bioorg. Med. Chem. Lett. 8(11) , 1317-20, (1998) 5'-Deoxy-5'-fluoro-O4-methylthymidine was synthesized by the reaction of the corresponding 5'-O-tosylate with KF in the presence of Kryptofix [222] and coupled to a 5'-phosphoramidite-activated CPG-bo... |
|
|
Simultaneous analysis of FDG, ClDG and Kryptofix 2.2.2 in [18F]FDG preparation by high-performance liquid chromatography with UV detection.
Nucl. Med. Biol. 35(2) , 239-44, (2008) A practical, sensitive and rapid analytical method was established and validated for chemical impurity tests of 2-deoxy-2-fluoro-d-glucose (FDG), 2-deoxy-2-chloro-d-glucose (ClDG) and Kryptofix 2.2.2 ... |
|
|
Transport of alkali cations through thin lipid membranes by (222)C10-cryptand, an ionizable mobile carrier.
J. Membr. Biol. 89(3) , 251-67, (1986) The kinetics of K+ and Na+ transport across the membrane of large unilamellar vesicles (L.U.V.) were compared at two pH's, with two carriers: (222)C10-cryptand (diaza-1,10-decyl-5-hexaoxa-4,7,13,16,21... |
| Crypt-2,2,2 |
| Cryptand 2.2.2 |
| Cryptate 222 |
| cryptating agent 222 |
| Ligand 222 |
| Kryptofix 222(R) |
| Kryptand 222 |
| EINECS 245-962-4 |
| Kryptofix Merck 222 |
| [2.2.2]Cryptand |
| 2.2.2-Kryptofix(R) |
| Cryptofix 222 |
| MFCD00005111 |
| kryptofix(R)2.2.2 |
| Cryptand C 222 |
| 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo(8.8.8)hexacosane |
| 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane |
| Kriptofix 222 |
| Cryptand 222 |
| 4,7,13,16,21, 24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane |
| Kryptofix 222 |