2-(6-Methoxynaphthalen-2-yl)acetic acid structure
|
Common Name | 2-(6-Methoxynaphthalen-2-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 23981-47-7 | Molecular Weight | 216.233 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 408.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C13H12O3 | Melting Point | 171-173ºC | |
| MSDS | Chinese USA | Flash Point | 160.7±15.3 °C | |
Use of 2-(6-Methoxynaphthalen-2-yl)acetic acidα-Demethylnaproxen is the major metabolite of Nabumetone (HY-B0559), Nabumetone is an orally active COX-2 inhibitor with anti-inflammatory activity[1][2]. |
| Name | (6-methoxy-2-naphthyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | α-Demethylnaproxen is the major metabolite of Nabumetone (HY-B0559), Nabumetone is an orally active COX-2 inhibitor with anti-inflammatory activity[1][2]. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.8±20.0 °C at 760 mmHg |
| Melting Point | 171-173ºC |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.233 |
| Flash Point | 160.7±15.3 °C |
| Exact Mass | 216.078644 |
| PSA | 46.53000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | PHJFLPMVEFKEPL-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(CC(=O)O)ccc2c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (6-Methoxy-2-naphthyl)acetic acid |
| (6-methoxynaphthalen-2-yl)acetic acid |
| 2-Naphthaleneacetic acid, 6-methoxy- |
| 6-Methoxy-2-naphthaleneacetic Acid |
| 2-(6-methoxynaphthalen-2-yl)acetic acid |