TLR8 agonist 5 structure
|
Common Name | TLR8 agonist 5 | ||
|---|---|---|---|---|
| CAS Number | 2413016-41-6 | Molecular Weight | 576.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H40N6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TLR8 agonist 5TLR8 agonist 5 is a potent TLR8 agonist with an EC50 value of 20 nM for HEK-Blue hTLR8. TLR8 agonist 5 activates the immune response[1]. |
| Name | TLR8 agonist 5 |
|---|
| Description | TLR8 agonist 5 is a potent TLR8 agonist with an EC50 value of 20 nM for HEK-Blue hTLR8. TLR8 agonist 5 activates the immune response[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Smith SW, et, al. Benzazepine compounds, conjugates, and uses thereof. WO2020056194. |
| Molecular Formula | C31H40N6O5 |
|---|---|
| Molecular Weight | 576.69 |
| InChIKey | UXDUNZGDEXDOEZ-UHFFFAOYSA-N |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)OCCNC(=O)C(C)(C)NC(=O)OCc1ccccc1 |