Ferroportin-IN-1 structure
|
Common Name | Ferroportin-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 2443432-65-1 | Molecular Weight | 464.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21FN8OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ferroportin-IN-1Ferroportin-IN-1 is a ferroportin inhibitor extracted from patent WO2020123850A1 compound 23. Ferroportin-IN-1 can be used for the research of diseases caused by a lack of hepcidin or iron metabolism disorders[1]. |
| Name | Ferroportin-IN-1 |
|---|
| Description | Ferroportin-IN-1 is a ferroportin inhibitor extracted from patent WO2020123850A1 compound 23. Ferroportin-IN-1 can be used for the research of diseases caused by a lack of hepcidin or iron metabolism disorders[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Li Z, et, al. Ferroportin inhibitors and methods of use. WO2020123850A1. |
| Molecular Formula | C22H21FN8OS |
|---|---|
| Molecular Weight | 464.52 |
| InChIKey | AMCFSVKOAOALFO-UHFFFAOYSA-N |
| SMILES | O=c1nc2sc(CCNCCc3nc4ccccc4[nH]3)nc2c(NCc2ncccc2F)[nH]1 |