KIF18A-IN-3 structure
|
Common Name | KIF18A-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 2600577-49-7 | Molecular Weight | 574.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H38N4O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KIF18A-IN-3KIF18A-IN-3 is a potent KIF18A inhibitor (IC50=61 nM). KIF18A-IN-3 causes significant mitotic arrest and increases the number of mitotic cells in tumor tissues. KIF18A-IN-3 can be used for researching cancer[1]. |
| Name | KIF18A-IN-3 |
|---|
| Description | KIF18A-IN-3 is a potent KIF18A inhibitor (IC50=61 nM). KIF18A-IN-3 causes significant mitotic arrest and increases the number of mitotic cells in tumor tissues. KIF18A-IN-3 can be used for researching cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 61 nM (KIF18A)[1] |
| In Vivo | KIF18A-IN-3 (compound 24) exhibits a significant and sustained pharmacodynamic response, increasing the number of mitotic cells (pH3 positive cells) in tumor tissues for up to 24 hours[1].Pharmacokinetic Parameters of KIF18A-IN-3 in female CD-1 mice[1]. IP (100 mg/kg) Cmax (μM) 26.5 AUC0-24 (μM·h) 269 C24h (μM) 0.8 PPB (fu) 0.015 Animal Model: Female athymic nude mice (4-7 weeks; injected with human OVCAR-3 HGSOC cells)[1] Dosage: 100 mg/kg Administration: i.p., single Result: Showed a significant and sustained pharmacodynamic response, increasing the number of mitotic cells (pH3 positive cells) in tumor tissues for up to 24 hours. |
| References |
| Molecular Formula | C28H38N4O5S2 |
|---|---|
| Molecular Weight | 574.76 |
| InChIKey | MZGYQJDGUVDYIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(NC(=O)c2ccc(NS(=O)(=O)C3(C)CC3)cc2N2CCC3(CC2)CC3)c1 |